Phenol, 2,6-dichloro-4-isocyanato
Modify Date: 2025-09-08 19:14:29
Phenol, 2,6-dichloro-4-isocyanato structure
|
Common Name | Phenol, 2,6-dichloro-4-isocyanato | ||
|---|---|---|---|---|
| CAS Number | 23159-75-3 | Molecular Weight | 204.01 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Phenol, 2,6-dichloro-4-isocyanato |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H3Cl2NO2 |
|---|---|
| Molecular Weight | 204.01 |
| InChIKey | AXGYYVGLQJIQCZ-UHFFFAOYSA-N |
| SMILES | O=C=Nc1cc(Cl)c(O)c(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Phenol, 2,6-dichloro-4-isocyanato? |
| A: CAS number of Phenol, 2,6-dichloro-4-isocyanato is 23159-75-3. |
| Q: What is the molecular formula of Phenol, 2,6-dichloro-4-isocyanato? |
| A: Molecular formula of Phenol, 2,6-dichloro-4-isocyanato is C7H3Cl2NO2. |
| Q: What is the InChIKey of Phenol, 2,6-dichloro-4-isocyanato? |
| A: InChIKey of Phenol, 2,6-dichloro-4-isocyanato is AXGYYVGLQJIQCZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Phenol, 2,6-dichloro-4-isocyanato? |
| A: Molecular weight of Phenol, 2,6-dichloro-4-isocyanato is 204.01. |
| Q: What is the English name of Phenol, 2,6-dichloro-4-isocyanato? |
| A: The English name of Phenol, 2,6-dichloro-4-isocyanato is Phenol, 2,6-dichloro-4-isocyanato. |
| Q: What is the Chinese name of 23159-75-3? |
| A: Chinese name of 23159-75-3 is 23159-75-3. |
| Q: What is the SMILES notation of Phenol, 2,6-dichloro-4-isocyanato? |
| A: SMILES notation of Phenol, 2,6-dichloro-4-isocyanato is O=C=Nc1cc(Cl)c(O)c(Cl)c1. |