Silane,dioxybis[triphenyl- (9CI) structure
|
Common Name | Silane,dioxybis[triphenyl- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 2319-39-3 | Molecular Weight | 550.79300 | |
| Density | 1.17g/cm3 | Boiling Point | 604.8ºC at 760mmHg | |
| Molecular Formula | C36H30O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.6ºC | |
| Name | triphenyl(triphenylsilylperoxy)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 604.8ºC at 760mmHg |
| Molecular Formula | C36H30O2Si2 |
| Molecular Weight | 550.79300 |
| Flash Point | 252.6ºC |
| Exact Mass | 550.17800 |
| PSA | 18.46000 |
| LogP | 4.26880 |
| Vapour Pressure | 6.2E-14mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | IJSPNPSQIMOSAU-UHFFFAOYSA-N |
| SMILES | c1ccc([Si](OO[Si](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Bis-(triphenylsilyl)-peroxid |
| Silane,dioxybis[triphenyl-(9CI) |
| dioxybis(triphenylsilane) |
| bis-triphenylsilanyl peroxide |
| bis(triphenylsilyl) peroxide |