((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone
Modify Date: 2025-09-09 22:31:27
![((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone Structure](https://www.chemsrc.com/extcaspic/257/2320147-83-7.png)
((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone structure
|
Common Name | ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 2320147-83-7 | Molecular Weight | 246.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18N2O2 |
|---|---|
| Molecular Weight | 246.30 |
| InChIKey | JYTMDURUARAKNR-UHFFFAOYSA-N |
| SMILES | COC1CC2CCC(C1)N2C(=O)c1ccncc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone? |
| A: CAS number of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone is 2320147-83-7. |
| Q: What is the SMILES notation of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone? |
| A: SMILES notation of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone is COC1CC2CCC(C1)N2C(=O)c1ccncc1. |
| Q: What is the molecular formula of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone? |
| A: Molecular formula of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone is C14H18N2O2. |
| Q: What is the molecular weight of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone? |
| A: Molecular weight of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone is 246.30. |
| Q: What is the Chinese name of 2320147-83-7? |
| A: Chinese name of 2320147-83-7 is 2320147-83-7. |
| Q: What is the InChIKey of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone? |
| A: InChIKey of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone is JYTMDURUARAKNR-UHFFFAOYSA-N. |
| Q: What is the English name of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone? |
| A: The English name of ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone is ((1R,5S)-3-methoxy-8-azabicyclo[3.2.1]octan-8-yl)(pyridin-4-yl)methanone. |