5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride
Modify Date: 2025-09-06 17:43:08
5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride structure
|
Common Name | 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2320221-74-5 | Molecular Weight | 307.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18ClN3O2 |
|---|---|
| Molecular Weight | 307.77 |
| InChIKey | AIVFPUCOEGXHFI-UHFFFAOYSA-N |
| SMILES | Cl.c1cc(-c2noc(C3CC3)n2)ccc1OC1CCNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2320221-74-5? |
| A: Chinese name of 2320221-74-5 is 2320221-74-5. |
| Q: What is the InChIKey of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride? |
| A: InChIKey of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride is AIVFPUCOEGXHFI-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride? |
| A: Molecular weight of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride is 307.77. |
| Q: What is the molecular formula of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride? |
| A: Molecular formula of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride is C15H18ClN3O2. |
| Q: What is the English name of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride? |
| A: The English name of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride is 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride. |
| Q: What is the SMILES notation of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride? |
| A: SMILES notation of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride is Cl.c1cc(-c2noc(C3CC3)n2)ccc1OC1CCNC1. |
| Q: What is the CAS number of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride? |
| A: CAS number of 5-Cyclopropyl-3-(4-(pyrrolidin-3-yloxy)phenyl)-1,2,4-oxadiazole hydrochloride is 2320221-74-5. |