1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride
Modify Date: 2026-07-08 17:06:52
1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride structure
|
Common Name | 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2320923-47-3 | Molecular Weight | 278.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H17Cl2NO2 |
|---|---|
| Molecular Weight | 278.17 |
| InChIKey | YFNZQBXZJRKMSN-UHFFFAOYSA-N |
| SMILES | COc1cccc(CN2CCC(O)C2)c1Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride? |
| A: CAS number of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride is 2320923-47-3. |
| Q: What is the English name of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride? |
| A: The English name of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride is 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride. |
| Q: What is the molecular weight of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride? |
| A: Molecular weight of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride is 278.17. |
| Q: What is the molecular formula of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride? |
| A: Molecular formula of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride is C12H17Cl2NO2. |
| Q: What is the Chinese name of 2320923-47-3? |
| A: Chinese name of 2320923-47-3 is 2320923-47-3. |
| Q: What is the InChIKey of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride? |
| A: InChIKey of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride is YFNZQBXZJRKMSN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride? |
| A: SMILES notation of 1-(2-Chloro-3-methoxybenzyl)pyrrolidin-3-ol hydrochloride is COc1cccc(CN2CCC(O)C2)c1Cl.Cl. |