3-METHYL-1-PHENYLINDOLIN-2-ONE structure
|
Common Name | 3-METHYL-1-PHENYLINDOLIN-2-ONE | ||
|---|---|---|---|---|
| CAS Number | 23210-22-2 | Molecular Weight | 223.27000 | |
| Density | 1.173g/cm3 | Boiling Point | 417.4ºC at 760mmHg | |
| Molecular Formula | C15H13NO | Melting Point | 78-81ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 202.2ºC | |
| Name | 3-methyl-1-phenyl-3H-indol-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 417.4ºC at 760mmHg |
| Melting Point | 78-81ºC(lit.) |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27000 |
| Flash Point | 202.2ºC |
| Exact Mass | 223.10000 |
| PSA | 20.31000 |
| LogP | 3.53340 |
| Vapour Pressure | 3.54E-07mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | DJKASMOURATDIE-UHFFFAOYSA-N |
| SMILES | CC1C(=O)N(c2ccccc2)c2ccccc21 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933790090 |
|
~60%
3-METHYL-1-PHEN... CAS#:23210-22-2 |
| Literature: Bowman, W. Russell; Westlake, Paul J. Tetrahedron, 1992 , vol. 48, # 19 p. 4027 - 4038 |
|
~14%
3-METHYL-1-PHEN... CAS#:23210-22-2 |
| Literature: Helvetica Chimica Acta, , vol. 88, # 1 p. 35 - 41 |
|
~17%
3-METHYL-1-PHEN... CAS#:23210-22-2 |
| Literature: Helvetica Chimica Acta, , vol. 88, # 1 p. 35 - 41 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
| 3-methyl-1-phenyl-2,3-dihydro-1H-indol-2-one |
| 3-methyl-1-phenylindolin-2-one |
| 3-methyl-1-phenyl-1,3-dihydro-indol-2-one |
| 3-methyl-1-phenyloxindole |
| 3-methyl-N-phenyloxindole |
| MFCD00798609 |
| 3-methyl-2-phenyloxindole |
| 1-Phenyl-3-methylindolin-2-one |
| 3-Methyl-1-phenylindoline-2-one |