(E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine structure
|
Common Name | (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2321335-06-0 | Molecular Weight | 286.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14N2O2S |
|---|---|
| Molecular Weight | 286.4 |
| InChIKey | KYONVYXYXKXKSO-CSKARUKUSA-N |
| SMILES | O=S(=O)(C=Cc1ccccc1)N1Cc2cccnc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine? |
| A: InChIKey of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is KYONVYXYXKXKSO-CSKARUKUSA-N. |
| Q: What is the SMILES notation of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine? |
| A: SMILES notation of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is O=S(=O)(C=Cc1ccccc1)N1Cc2cccnc2C1. |
| Q: What is the molecular weight of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine? |
| A: Molecular weight of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is 286.4. |
| Q: What is the CAS number of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine? |
| A: CAS number of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is 2321335-06-0. |
| Q: What is the Chinese name of 2321335-06-0? |
| A: Chinese name of 2321335-06-0 is 2321335-06-0. |
| Q: What is the English name of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine? |
| A: The English name of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine. |
| Q: What is the molecular formula of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine? |
| A: Molecular formula of (E)-6-(styrylsulfonyl)-6,7-dihydro-5H-pyrrolo[3,4-b]pyridine is C15H14N2O2S. |