Phenol,4-(5,6-dihydroimidazo[2,1-b]thiazol-3-yl)-, hydrobromide (1:1) structure
|
Common Name | Phenol,4-(5,6-dihydroimidazo[2,1-b]thiazol-3-yl)-, hydrobromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 23224-08-0 | Molecular Weight | 299.18700 | |
| Density | 1.44g/cm3 | Boiling Point | 420.2ºC at 760mmHg | |
| Molecular Formula | C11H11BrN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 4-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)phenol |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 420.2ºC at 760mmHg |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.18700 |
| Flash Point | 207.9ºC |
| Exact Mass | 297.97800 |
| PSA | 65.76000 |
| LogP | 2.23020 |
| Vapour Pressure | 1.17E-07mmHg at 25°C |
| Index of Refraction | 1.743 |
| InChIKey | VHAXYBWGPIXDEA-UHFFFAOYSA-N |
| SMILES | Oc1ccc(C2=CSC3=NCCN23)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |