Methyl 2,6-dichloro-4-aminobenzoate structure
|
Common Name | Methyl 2,6-dichloro-4-aminobenzoate | ||
|---|---|---|---|---|
| CAS Number | 232275-49-9 | Molecular Weight | 220.05300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-amino-2,6-dichlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7Cl2NO2 |
|---|---|
| Molecular Weight | 220.05300 |
| Exact Mass | 218.98500 |
| PSA | 52.32000 |
| LogP | 2.94340 |
| InChIKey | KBMZQFQCPXVGJR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)N)Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3,5-dichloroanisidine |
| 4-Amino-2,6-dichlorobenzoic acid methyl ester |
| 3,5-Dichlor-4-methoxy-anilin |
| Benzenamine,3,5-dichloro-4-methoxy |
| 3,5-dichloro-4-methoxy-aniline |
| 3.5-Dichlor-p-anisidin |
| 4-Amino-2,6-dichloroanisole |