6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine
Modify Date: 2026-07-10 20:08:58
![6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine Structure](https://www.chemsrc.com/extcaspic/251/2324696-95-7.png)
6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine structure
|
Common Name | 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine | ||
|---|---|---|---|---|
| CAS Number | 2324696-95-7 | Molecular Weight | 294.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11ClN2O2S |
|---|---|
| Molecular Weight | 294.76 |
| InChIKey | NWRDNADIEQAIRZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1Cc2cccnc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine? |
| A: Molecular weight of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine is 294.76. |
| Q: What is the SMILES notation of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine? |
| A: SMILES notation of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine is O=S(=O)(c1ccc(Cl)cc1)N1Cc2cccnc2C1. |
| Q: What is the English name of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine? |
| A: The English name of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine is 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine. |
| Q: What is the Chinese name of 2324696-95-7? |
| A: Chinese name of 2324696-95-7 is 2324696-95-7. |
| Q: What is the CAS number of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine? |
| A: CAS number of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine is 2324696-95-7. |
| Q: What is the molecular formula of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine? |
| A: Molecular formula of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine is C13H11ClN2O2S. |
| Q: What is the InChIKey of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine? |
| A: InChIKey of 6-(4-chlorobenzenesulfonyl)-5H,6H,7H-pyrrolo[3,4-b]pyridine is NWRDNADIEQAIRZ-UHFFFAOYSA-N. |