Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate
Modify Date: 2026-08-21 10:58:48
![Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate Structure](https://www.chemsrc.com/extcaspic/443/2325359-06-4.png)
Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate structure
|
Common Name | Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate | ||
|---|---|---|---|---|
| CAS Number | 2325359-06-4 | Molecular Weight | 253.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H23NO3 |
|---|---|
| Molecular Weight | 253.34 |
| InChIKey | GHCVAVYMOZFWST-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(NCc1ccco1)C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2325359-06-4? |
| A: Chinese name of 2325359-06-4 is 2325359-06-4. |
| Q: What is the English name of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate? |
| A: The English name of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate is Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate. |
| Q: What is the InChIKey of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate? |
| A: InChIKey of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate is GHCVAVYMOZFWST-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate? |
| A: Molecular formula of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate is C14H23NO3. |
| Q: What is the molecular weight of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate? |
| A: Molecular weight of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate is 253.34. |
| Q: What is the CAS number of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate? |
| A: CAS number of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate is 2325359-06-4. |
| Q: What is the SMILES notation of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate? |
| A: SMILES notation of Ethyl 3-{[(furan-2-yl)methyl]amino}-4,4-dimethylpentanoate is CCOC(=O)CC(NCc1ccco1)C(C)(C)C. |