1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide structure
|
Common Name | 1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 23256-12-4 | Molecular Weight | 225.24600 | |
| Density | 1.371g/cm3 | Boiling Point | 505.4ºC at 760mmHg | |
| Molecular Formula | C13H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.5ºC | |
| Name | 1-methyl-9H-pyrido[3,4-b]indole-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 505.4ºC at 760mmHg |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.24600 |
| Flash Point | 259.5ºC |
| Exact Mass | 225.09000 |
| PSA | 71.77000 |
| LogP | 2.82370 |
| Vapour Pressure | 2.43E-10mmHg at 25°C |
| Index of Refraction | 1.769 |
| InChIKey | WWOQNKXXDOLCLH-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(N)=O)cc2c1[nH]c1ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| gpa 127 |