5-bromo-4-chloro-4,5,5-trifluoropent-2-enoic acid
Modify Date: 2025-08-25 19:03:17
5-bromo-4-chloro-4,5,5-trifluoropent-2-enoic acid structure
|
Common Name | 5-bromo-4-chloro-4,5,5-trifluoropent-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 232602-80-1 | Molecular Weight | 267.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H3BrClF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-4-chloro-4,5,5-trifluoropent-2-enoic acid |
|---|
| Molecular Formula | C5H3BrClF3O2 |
|---|---|
| Molecular Weight | 267.42800 |
| Exact Mass | 265.89600 |
| PSA | 37.30000 |
| LogP | 2.51950 |
| InChIKey | DNFYVWJPGXJDRN-OWOJBTEDSA-N |
| SMILES | O=C(O)C=CC(F)(Cl)C(F)(F)Br |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |