beta-ionone epoxide structure
|
Common Name | beta-ionone epoxide | ||
|---|---|---|---|---|
| CAS Number | 23267-57-4 | Molecular Weight | 208.29700 | |
| Density | 1.075g/cm3 | Boiling Point | 275.1ºC at 760mmHg | |
| Molecular Formula | C13H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 103.7ºC | |
| Name | β-ionone 5,6-epoxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.075g/cm3 |
|---|---|
| Boiling Point | 275.1ºC at 760mmHg |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.29700 |
| Flash Point | 103.7ºC |
| Exact Mass | 208.14600 |
| PSA | 29.60000 |
| LogP | 2.86940 |
| Vapour Pressure | 0.0052mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | ZTJZJYUGOJYHCU-RMKNXTFCSA-N |
| SMILES | CC(=O)C=CC12OC1(C)CCCC2(C)C |
| HS Code | 2932999099 |
|---|
|
~90%
beta-ionone epoxide CAS#:23267-57-4 |
| Literature: Srikrishna; Anitha Nagamani Journal of the Chemical Society - Perkin Transactions 1, 1999 , # 23 p. 3393 - 3394 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Buten-2-one,4-(2,2,6-trimethyl-7-oxabicyclo(4.1.0)hept-1-yl) |
| beta-ionone 5,6-epoxide |
| 4-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]hept-1-yl)but-3-en-2-one |
| 4-(2,2,6-Trimethyl-7-oxabicyclo(4.1.0)hept-1-yl)-3-buten-2-one |
| 4-(1,2-Epoxy-2,6,6-trimethylcyclohexyl)-3-butenone-2 |
| EINECS 245-542-0 |
| 4-(1,5,5-trimethyl-7-oxabicyclo[4.1.0]heptan-6-yl)but-3-en-2-one |