N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide
Modify Date: 2026-07-04 07:39:20
![N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide Structure](https://www.chemsrc.com/extcaspic/306/2327432-53-9.png)
N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide structure
|
Common Name | N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 2327432-53-9 | Molecular Weight | 268.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10F2N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H10F2N2OS |
|---|---|
| Molecular Weight | 268.28 |
| InChIKey | FFCBDDIWQGRMNQ-UHFFFAOYSA-N |
| SMILES | Cc1ncsc1C(=O)NCc1c(F)cccc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2327432-53-9? |
| A: Chinese name of 2327432-53-9 is 2327432-53-9. |
| Q: What is the InChIKey of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide? |
| A: InChIKey of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide is FFCBDDIWQGRMNQ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide? |
| A: Molecular formula of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide is C12H10F2N2OS. |
| Q: What is the English name of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide? |
| A: The English name of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide is N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide. |
| Q: What is the CAS number of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide? |
| A: CAS number of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide is 2327432-53-9. |
| Q: What is the SMILES notation of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide? |
| A: SMILES notation of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide is Cc1ncsc1C(=O)NCc1c(F)cccc1F. |
| Q: What is the molecular weight of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide? |
| A: Molecular weight of N-[(2,6-difluorophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide is 268.28. |