1(2H)-Phthalazinone,4-[(2-hydroxyethyl)amino]- structure
|
Common Name | 1(2H)-Phthalazinone,4-[(2-hydroxyethyl)amino]- | ||
|---|---|---|---|---|
| CAS Number | 23279-81-4 | Molecular Weight | 205.21300 | |
| Density | 1.41g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H11N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-hydroxyethylamino)-2H-phthalazin-1-one |
|---|
| Density | 1.41g/cm3 |
|---|---|
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.21300 |
| Exact Mass | 205.08500 |
| PSA | 78.01000 |
| LogP | 0.40030 |
| Index of Refraction | 1.672 |
| InChIKey | XFDFUCJMZJILRD-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(NCCO)c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
1(2H)-Phthalazi... CAS#:23279-81-4 |
| Literature: Klamerth Chemische Berichte, 1951 , vol. 84, p. 254,256 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |