2-(1-adamantyl)benzimidazole structure
|
Common Name | 2-(1-adamantyl)benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 23280-73-1 | Molecular Weight | 252.35400 | |
| Density | 1.236g/cm3 | Boiling Point | 465.1ºC at 760mmHg | |
| Molecular Formula | C17H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4ºC | |
| Name | 2-(1-adamantyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 465.1ºC at 760mmHg |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.35400 |
| Flash Point | 249.4ºC |
| Exact Mass | 252.16300 |
| PSA | 28.68000 |
| LogP | 4.03070 |
| Vapour Pressure | 2.2E-08mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | VZJQLKDAEBGCCW-UHFFFAOYSA-N |
| SMILES | c1ccc2[nH]c(C34CC5CC(CC(C5)C3)C4)nc2c1 |
| HS Code | 2933990090 |
|---|
|
~44%
2-(1-adamantyl)... CAS#:23280-73-1 |
| Literature: Tsupak, E. B.; Vikhryanova, I. V. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1984 , vol. 20, # 12 p. 1401 Khimiya Geterotsiklicheskikh Soedinenii, 1984 , # 12 p. 1695 |
|
~53%
2-(1-adamantyl)... CAS#:23280-73-1 |
| Literature: Pellicciari; Fioretti; Cogolli; Tiecco Arzneimittel-Forschung/Drug Research, 1980 , vol. 30, # 12 p. 2103 - 2105 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-adamantanylbenzimidazole |
| 2-adamantyl-1H-benzimidazole |
| 2-adamantylbenzimidazole |
| 2-ADAMANTAN-1-YL-1H-BENZOIMIDAZOLE |