Benzoic acid,4-chloro-, 2-[(4-chlorophenyl)methylene]hydrazide structure
|
Common Name | Benzoic acid,4-chloro-, 2-[(4-chlorophenyl)methylene]hydrazide | ||
|---|---|---|---|---|
| CAS Number | 23289-03-4 | Molecular Weight | 293.14800 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-N-[(E)-(4-chlorophenyl)methylideneamino]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C14H10Cl2N2O |
| Molecular Weight | 293.14800 |
| Exact Mass | 292.01700 |
| PSA | 41.46000 |
| LogP | 4.14820 |
| Index of Refraction | 1.606 |
| InChIKey | SWHJISKQXOLDMI-MFOYZWKCSA-N |
| SMILES | O=C(NN=Cc1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| t0400-1020 |
| t4919 |