N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide
Modify Date: 2025-09-09 17:56:39
![N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide Structure](https://www.chemsrc.com/extcaspic/189/2330514-37-7.png)
N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide structure
|
Common Name | N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 2330514-37-7 | Molecular Weight | 349.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19N5O3S |
|---|---|
| Molecular Weight | 349.4 |
| InChIKey | JIKAXZPIOBUCQX-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2cnc(N(C)C)nc2)c(C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide? |
| A: CAS number of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide is 2330514-37-7. |
| Q: What is the English name of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide? |
| A: The English name of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide is N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide. |
| Q: What is the molecular formula of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide? |
| A: Molecular formula of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide is C15H19N5O3S. |
| Q: What is the InChIKey of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide? |
| A: InChIKey of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide is JIKAXZPIOBUCQX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide? |
| A: SMILES notation of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide is CC(=O)Nc1ccc(S(=O)(=O)Nc2cnc(N(C)C)nc2)c(C)c1. |
| Q: What is the molecular weight of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide? |
| A: Molecular weight of N-(4-{[2-(dimethylamino)pyrimidin-5-yl]sulfamoyl}-3-methylphenyl)acetamide is 349.4. |
| Q: What is the Chinese name of 2330514-37-7? |
| A: Chinese name of 2330514-37-7 is 2330514-37-7. |