Punicagaranine
Modify Date: 2026-07-08 16:29:44
Punicagaranine structure
|
Common Name | Punicagaranine | ||
|---|---|---|---|---|
| CAS Number | 2334105-13-2 | Molecular Weight | 245.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Punicagaranine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11NO4 |
|---|---|
| Molecular Weight | 245.23 |
| InChIKey | VTEXWWBYSBRMMO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(=O)c2ccco2)n2c1CCC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Punicagaranine? |
| A: SMILES notation of Punicagaranine is O=C(O)c1cc(C(=O)c2ccco2)n2c1CCC2. |
| Q: What is the molecular formula of Punicagaranine? |
| A: Molecular formula of Punicagaranine is C13H11NO4. |
| Q: What is the molecular weight of Punicagaranine? |
| A: Molecular weight of Punicagaranine is 245.23. |
| Q: What is the Chinese name of 2334105-13-2? |
| A: Chinese name of 2334105-13-2 is 2334105-13-2. |
| Q: What is the English name of Punicagaranine? |
| A: The English name of Punicagaranine is Punicagaranine. |
| Q: What is the CAS number of Punicagaranine? |
| A: CAS number of Punicagaranine is 2334105-13-2. |
| Q: What is the InChIKey of Punicagaranine? |
| A: InChIKey of Punicagaranine is VTEXWWBYSBRMMO-UHFFFAOYSA-N. |