1-(4-Nitrophenyl)cyclopropanecarboxylic acid structure
|
Common Name | 1-(4-Nitrophenyl)cyclopropanecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 23348-99-4 | Molecular Weight | 207.183 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 403.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.6±15.2 °C | |
| Name | 1-(4-nitrophenyl)cyclopropane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 403.8±38.0 °C at 760 mmHg |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.183 |
| Flash Point | 179.6±15.2 °C |
| Exact Mass | 207.053162 |
| PSA | 83.12000 |
| LogP | 1.28 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | GWOWMWDHYGMVSZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C1(c2ccc([N+](=O)[O-])cc2)CC1 |
| Storage condition | 2-8°C |
| HS Code | 2916399090 |
|---|
|
~63%
1-(4-Nitropheny... CAS#:23348-99-4 |
| Literature: WO2005/34837 A2, ; Page/Page column 46 ; WO 2005/034837 A2 |
|
~%
1-(4-Nitropheny... CAS#:23348-99-4 |
| Literature: Journal of Organic Chemistry, , vol. 63, # 12 p. 3814 - 3820 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-(4-Nitrophenyl)cyclopropanecarboxylic acid |
| Cyclopropanecarboxylic acid, 1-(4-nitrophenyl)- |