Plumbane,diiododiphenyl- structure
|
Common Name | Plumbane,diiododiphenyl- | ||
|---|---|---|---|---|
| CAS Number | 23351-01-1 | Molecular Weight | 615.21700 | |
| Density | N/A | Boiling Point | 427.5ºC at 760mmHg | |
| Molecular Formula | C12H10I2Pb | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.4ºC | |
| Name | diiodo(diphenyl)plumbane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 427.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H10I2Pb |
| Molecular Weight | 615.21700 |
| Flash Point | 212.4ºC |
| Exact Mass | 615.86400 |
| LogP | 4.36420 |
| Vapour Pressure | 4.05E-07mmHg at 25°C |
| InChIKey | BFHVTWLEVILIOF-UHFFFAOYSA-L |
| SMILES | I[Pb](I)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Plumbane,diiododiphenyl |
| diphenyldiiodoplumbane |
| diphenyl lead (2+),diiodide |
| Diphenyl-blei(2+),Dijodid |
| DIIODO-DIPHENYL-PLUMBANE |
| diphenyllead diiodide |