(±)-cis-2-(Boc-amino)-3-cyclohexene-1-carboxylic acid structure
|
Common Name | (±)-cis-2-(Boc-amino)-3-cyclohexene-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 233600-33-4 | Molecular Weight | 241.284 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 399.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 195.2±27.9 °C | |
| Name | 8320649 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 399.2±42.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 195.2±27.9 °C |
| Exact Mass | 241.131409 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | QWRRLPZJKAWOFL-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)NC1C=CCCC1C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| MFCD09750520 |
| N-Boc-cis-2-amino-3-cyclohexene-1-carboxylic acid |
| (1R,2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-cyclohexene-1-carboxylic acid |
| 8320649 |
| (1R,2S)-2-[(tert-Butoxycarbonyl)amino]cyclohex-3-ene-1-carboxylic acid |
| 3-Cyclohexene-1-carboxylic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, (1R,2S)- |
| cis-2-tert-Butoxycarbonylamino-cyclohex-3-enecarboxylic acid |
| (±)-cis-2-(Boc-amino)-3-cyclohexene-1-carboxylic acid |