(E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one structure
|
Common Name | (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 23366-83-8 | Molecular Weight | 322.11100 | |
| Density | 1.605g/cm3 | Boiling Point | 448.7ºC at 760mmHg | |
| Molecular Formula | C13H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 448.7ºC at 760mmHg |
| Molecular Formula | C13H8BrNO4 |
| Molecular Weight | 322.11100 |
| Flash Point | 225.2ºC |
| Exact Mass | 320.96400 |
| PSA | 76.03000 |
| LogP | 4.36960 |
| Vapour Pressure | 3.04E-08mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | KFHJWWYSIYEQTP-FNORWQNLSA-N |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)c1ccc(Br)cc1 |
|
~%
(E)-1-(4-bromop... CAS#:23366-83-8 |
| Literature: Tawari, Nilesh R.; Bairwa, Ranjeet; Ray; Rajan; Degani, Mariam S. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 21 p. 6175 - 6178 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| f0791-0002 |