(E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one
(E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one structure
|
Common Name | (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 23366-83-8 | Molecular Weight | 322.11100 | |
| Density | 1.605g/cm3 | Boiling Point | 448.7ºC at 760mmHg | |
| Molecular Formula | C13H8BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 448.7ºC at 760mmHg |
| Molecular Formula | C13H8BrNO4 |
| Molecular Weight | 322.11100 |
| Flash Point | 225.2ºC |
| Exact Mass | 320.96400 |
| PSA | 76.03000 |
| LogP | 4.36960 |
| Vapour Pressure | 3.04E-08mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | KFHJWWYSIYEQTP-FNORWQNLSA-N |
| SMILES | O=C(C=Cc1ccc([N+](=O)[O-])o1)c1ccc(Br)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
(E)-1-(4-bromop... CAS#:23366-83-8 |
| Literature: Tawari, Nilesh R.; Bairwa, Ranjeet; Ray; Rajan; Degani, Mariam S. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 21 p. 6175 - 6178 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| f0791-0002 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: InChIKey of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is KFHJWWYSIYEQTP-FNORWQNLSA-N. |
| Q: What English synonyms does (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one have? |
| A: English synonyms of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one: f0791-0002. |
| Q: What are the upstream materials of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: Related upstream materials(CAS) of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one: 698-63-5;99-90-1. |
| Q: What is the polar surface area (PSA) of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: Polar surface area (PSA) of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is 76.03000. |
| Q: What is the boiling point of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: Boiling point of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is 448.7ºC at 760mmHg. |
| Q: What is the LogP of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: LogP of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is 4.36960. |
| Q: What is the CAS number of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: CAS number of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is 23366-83-8. |
| Q: What is the SMILES notation of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: SMILES notation of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is O=C(C=Cc1ccc([N+](=O)[O-])o1)c1ccc(Br)cc1. |
| Q: What is the Chinese name of 23366-83-8? |
| A: Chinese name of 23366-83-8 is 23366-83-8. |
| Q: What is the molecular formula of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one? |
| A: Molecular formula of (E)-1-(4-bromophenyl)-3-(5-nitrofuran-2-yl)prop-2-en-1-one is C13H8BrNO4. |