Chrysosplenol C structure
|
Common Name | Chrysosplenol C | ||
|---|---|---|---|---|
| CAS Number | 23370-16-3 | Molecular Weight | 360.31500 | |
| Density | 1.54g/cm3 | Boiling Point | 648ºC at 760mmHg | |
| Molecular Formula | C18H16O8 | Melting Point | 210-211 °C | |
| MSDS | N/A | Flash Point | 238.4ºC | |
| Name | chrysosplenol C |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 648ºC at 760mmHg |
| Melting Point | 210-211 °C |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.31500 |
| Flash Point | 238.4ºC |
| Exact Mass | 360.08500 |
| PSA | 118.59000 |
| LogP | 2.60260 |
| Vapour Pressure | 2.17E-17mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | QQBSPLCHDUCBNM-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3cc(OC)c(O)c(O)c3c(=O)c2OC)ccc1O |
| HS Code | 2914509090 |
|---|
|
~%
Chrysosplenol C CAS#:23370-16-3 |
| Literature: Brunet, Gunter; Ibrahim, Ragai K. Phytochemistry (Elsevier), 1980 , vol. 19, p. 741 - 746 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,6,4'-trihydroxy-3,7,3'-trimethoxyflavone |
| Chrysosplenol C |
| 4',5,6-trihydroxy-3,3',7-trimethoxyflavone |
| 3,7,3'-tri-methylquercetagetin |
| 5,6-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxychromen-4-one |
| quercetagetin 3,7,3'-trimethyl ether |
| 3,7,3'-O-trimethylquercetagetin |
| Trimethyl-3,3',7-quercetagetin |