2,4-Dichlorophenol trichloroacetate structure
|
Common Name | 2,4-Dichlorophenol trichloroacetate | ||
|---|---|---|---|---|
| CAS Number | 23399-81-7 | Molecular Weight | 308.37300 | |
| Density | 1.665g/cm3 | Boiling Point | 311.8ºC at 760 mmHg | |
| Molecular Formula | C8H3Cl5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.8ºC | |
| Name | (2,4-dichlorophenyl) 2,2,2-trichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.665g/cm3 |
|---|---|
| Boiling Point | 311.8ºC at 760 mmHg |
| Molecular Formula | C8H3Cl5O2 |
| Molecular Weight | 308.37300 |
| Flash Point | 124.8ºC |
| Exact Mass | 305.85800 |
| PSA | 26.30000 |
| LogP | 4.26900 |
| Vapour Pressure | 0.00055mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | VNVHPDIADHUZNF-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Cl)cc1Cl)C(Cl)(Cl)Cl |
| HS Code | 2915400090 |
|---|
| HS Code | 2915400090 |
|---|---|
| Summary | 2915400090 mono-, di- or trichloroacetic acids, their salts and esters |
| 2,4-Dichlorophenol trichloroacetate |
| Phenol,2,4-dichloro-,trichloroacetate |
| 2.4-Dichlor-1-trichloracetoxy-benzol |
| 2,4-Dichlorophenyl trichloroacetate |
| 2,4-Dichlor-phenyltrichloracetat |
| Acetic acid,trichloro-,2,4-dichlorophenyl ester |