ethenyl-[4-[4-[ethenyl(dimethyl)silyl]phenyl]phenyl]-dimethylsilane structure
|
Common Name | ethenyl-[4-[4-[ethenyl(dimethyl)silyl]phenyl]phenyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 234076-12-1 | Molecular Weight | 322.59100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethenyl-[4-[4-[ethenyl(dimethyl)silyl]phenyl]phenyl]-dimethylsilane |
|---|
| Molecular Formula | C20H26Si2 |
|---|---|
| Molecular Weight | 322.59100 |
| Exact Mass | 322.15700 |
| LogP | 4.63480 |
| InChIKey | DBVRDDFZKPZFEG-UHFFFAOYSA-N |
| SMILES | C=C[Si](C)(C)c1ccc(-c2ccc([Si](C)(C)C=C)cc2)cc1 |
|
~94%
ethenyl-[4-[4-[... CAS#:234076-12-1 |
| Literature: Majchrzak, Mariusz; Marciniec, Bogdan; Itami, Yujiro Advanced Synthesis and Catalysis, 2005 , vol. 347, # 9 p. 1285 - 1294 |
|
~29%
ethenyl-[4-[4-[... CAS#:234076-12-1 |
| Literature: Kettenbach GmbH and Co. KG Patent: US2005/171233 A1, 2005 ; Location in patent: Page/Page column 20 ; |