2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester
Modify Date: 2026-07-03 21:39:53
2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester structure
|
Common Name | 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 234098-60-3 | Molecular Weight | 276.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20N2O3 |
|---|---|
| Molecular Weight | 276.33 |
| InChIKey | ZKETUCKAECRXHE-UHFFFAOYSA-N |
| SMILES | CCCC1C(=O)NCCN1C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester? |
| A: Molecular weight of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester is 276.33. |
| Q: What is the Chinese name of 234098-60-3? |
| A: Chinese name of 234098-60-3 is 234098-60-3. |
| Q: What is the InChIKey of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester? |
| A: InChIKey of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester is ZKETUCKAECRXHE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester? |
| A: CAS number of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester is 234098-60-3. |
| Q: What is the molecular formula of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester? |
| A: Molecular formula of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester is C15H20N2O3. |
| Q: What is the SMILES notation of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester? |
| A: SMILES notation of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester is CCCC1C(=O)NCCN1C(=O)OCc1ccccc1. |
| Q: What is the English name of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester? |
| A: The English name of 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester is 2-Propyl-3-oxo-piperazine-1-carboxylic acid benzyl ester. |