nsc56143 structure
|
Common Name | nsc56143 | ||
|---|---|---|---|---|
| CAS Number | 2344-17-4 | Molecular Weight | 231.99100 | |
| Density | 1.711g/cm3 | Boiling Point | 201.6ºC at 760 mmHg | |
| Molecular Formula | C5H2Cl2F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 75.7ºC | |
| Name | 4,6-dichloro-2-(trifluoromethyl)pyrimidin-5-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.711g/cm3 |
|---|---|
| Boiling Point | 201.6ºC at 760 mmHg |
| Molecular Formula | C5H2Cl2F3N3 |
| Molecular Weight | 231.99100 |
| Flash Point | 75.7ºC |
| Exact Mass | 230.95800 |
| PSA | 51.80000 |
| LogP | 2.96560 |
| Vapour Pressure | 0.306mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | SCCIDUDZOMNNFU-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)nc(C(F)(F)F)nc1Cl |
| HS Code | 2933599090 |
|---|
|
~%
nsc56143 CAS#:2344-17-4 |
| Literature: WO2011/58478 A1, ; Page/Page column 36 ; WO 2011/058478 A1 |
|
~%
nsc56143 CAS#:2344-17-4 |
| Literature: WO2011/58478 A1, ; WO 2011/058478 A1 |
|
~%
nsc56143 CAS#:2344-17-4 |
| Literature: WO2011/58478 A1, ; WO 2011/058478 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-dichloro-2-trifluoromethyl-pyrimidin-5-ylamine |
| 4,6-Dichlor-5-amino-2-trifluormethylpyrimidin |
| 4,6-Dichloro-2-(trifluoromethyl)-5-pyrimidinamine |