1-prop-2-ynoxy-3-[4-(trifluoromethyl)anilino]propan-2-ol
Modify Date: 2025-09-20 20:14:33
![1-prop-2-ynoxy-3-[4-(trifluoromethyl)anilino]propan-2-ol Structure](https://image.chemsrc.com/caspic/352/23452-80-4.png)
1-prop-2-ynoxy-3-[4-(trifluoromethyl)anilino]propan-2-ol structure
|
Common Name | 1-prop-2-ynoxy-3-[4-(trifluoromethyl)anilino]propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 23452-80-4 | Molecular Weight | 273.25100 | |
| Density | 1.283g/cm3 | Boiling Point | 420.1ºC at 760 mmHg | |
| Molecular Formula | C13H14F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 1-prop-2-ynoxy-3-[4-(trifluoromethyl)anilino]propan-2-ol |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 420.1ºC at 760 mmHg |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25100 |
| Flash Point | 207.9ºC |
| Exact Mass | 273.09800 |
| PSA | 41.49000 |
| LogP | 2.20100 |
| Vapour Pressure | 8.29E-08mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | SNLNHWZYMQTTKB-UHFFFAOYSA-N |
| SMILES | C#CCOCC(O)CNc1ccc(C(F)(F)F)cc1 |
| HS Code | 2922509090 |
|---|
|
~%
1-prop-2-ynoxy-... CAS#:23452-80-4 |
| Literature: Fauron,C.; Douzon,C. Chimica Therapeutica, 1973 , vol. 8, p. 143 - 147 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![5-[(2-Propynyloxy)methyl]-3-[4-(trifluoromethyl)phenyl]-2-oxazolidinone structure](https://image.chemsrc.com/caspic/044/23598-48-3.png)
CAS#:23598-48-3| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |