4-Bromobenzenesulfonic acid 3-methoxy-1,3-dimethylbutyl ester
Modify Date: 2025-09-28 19:35:05
4-Bromobenzenesulfonic acid 3-methoxy-1,3-dimethylbutyl ester structure
|
Common Name | 4-Bromobenzenesulfonic acid 3-methoxy-1,3-dimethylbutyl ester | ||
|---|---|---|---|---|
| CAS Number | 23453-98-7 | Molecular Weight | 351.25700 | |
| Density | 1.353g/cm3 | Boiling Point | 407.3ºC at 760mmHg | |
| Molecular Formula | C13H19BrO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.1ºC | |
| Name | (4-methoxy-4-methylpentan-2-yl) 4-bromobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.353g/cm3 |
|---|---|
| Boiling Point | 407.3ºC at 760mmHg |
| Molecular Formula | C13H19BrO4S |
| Molecular Weight | 351.25700 |
| Flash Point | 200.1ºC |
| Exact Mass | 350.01900 |
| PSA | 60.98000 |
| LogP | 4.43880 |
| Vapour Pressure | 1.8E-06mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | PMRGKKKILGALMX-UHFFFAOYSA-N |
| SMILES | COC(C)(C)CC(C)OS(=O)(=O)c1ccc(Br)cc1 |
| HS Code | 2909499000 |
|---|
| HS Code | 2909499000 |
|---|---|
| Summary | 2909499000. ether-alcohols and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Benzenesulfonic acid,p-bromo-,4-methoxy-4-methyl-2-pentyl ester |
| 4-methoxy-4-methylpentan-2-yl 4-bromobenzenesulfonate |
| 4-Methoxy-4-methyl-2-pentyl-p-bromobenzenesulfonate |