3,16,19-trihydroxy-5-androsten-17-one
3,16,19-trihydroxy-5-androsten-17-one structure
|
Common Name | 3,16,19-trihydroxy-5-androsten-17-one | ||
|---|---|---|---|---|
| CAS Number | 23457-40-1 | Molecular Weight | 320.42300 | |
| Density | 1.26g/cm3 | Boiling Point | 523.9ºC at 760 mmHg | |
| Molecular Formula | C19H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.7ºC | |
Summary: 3,16,19-Trimethyl-5-androsten-17-one (CAS: 23457-40-1), molecular formula C19H28O4, molecular weight 320.42300, density 1.26g/cm3, boiling point 523.9ºC. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,16,19-trihydroxy-5-androsten-17-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 523.9ºC at 760 mmHg |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.42300 |
| Flash Point | 284.7ºC |
| Exact Mass | 320.19900 |
| PSA | 77.76000 |
| LogP | 1.82240 |
| Vapour Pressure | 3.64E-13mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | DAFZPRAMJKYZNI-PMIQAHKFSA-N |
| SMILES | CC12CCC3C(CC=C4CC(O)CCC43CO)C1CC(O)C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
3,16,19-trihydr... CAS#:23457-40-1 |
| Literature: Numazawa; Mutsumi; Ogata; Osawa Steroids, 1987 , vol. 49, # 4-5 p. 247 - 257 |
|
~%
3,16,19-trihydr... CAS#:23457-40-1 |
| Literature: Petersen; Colas Steroids, 1969 , vol. 13, # 6 p. 793 - 802 |
|
~%
3,16,19-trihydr... CAS#:23457-40-1 |
| Literature: Petersen; Colas Steroids, 1969 , vol. 13, # 6 p. 793 - 802 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: Boiling point of 3,16,19-trihydroxy-5-androsten-17-one is 523.9ºC at 760 mmHg. |
| Q: What is the polar surface area (PSA) of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: Polar surface area (PSA) of 3,16,19-trihydroxy-5-androsten-17-one is 77.76000. |
| Q: What is the English name of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: The English name of 3,16,19-trihydroxy-5-androsten-17-one is 3,16,19-trihydroxy-5-androsten-17-one. |
| Q: What is the Chinese name of 23457-40-1? |
| A: Chinese name of 23457-40-1 is 23457-40-1. |
| Q: What is the InChIKey of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: InChIKey of 3,16,19-trihydroxy-5-androsten-17-one is DAFZPRAMJKYZNI-PMIQAHKFSA-N. |
| Q: What is the molecular formula of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: Molecular formula of 3,16,19-trihydroxy-5-androsten-17-one is C19H28O4. |
| Q: What is the LogP of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: LogP of 3,16,19-trihydroxy-5-androsten-17-one is 1.82240. |
| Q: What is the SMILES notation of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: SMILES notation of 3,16,19-trihydroxy-5-androsten-17-one is CC12CCC3C(CC=C4CC(O)CCC43CO)C1CC(O)C2=O. |
| Q: What are the upstream materials of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: Related upstream materials(CAS) of 3,16,19-trihydroxy-5-androsten-17-one: 2685-64-5;2857-45-6. |
| Q: What is the molecular weight of 3,16,19-trihydroxy-5-androsten-17-one? |
| A: Molecular weight of 3,16,19-trihydroxy-5-androsten-17-one is 320.42300. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |