N-[cyclopropyl(phenyl)methyl]-2-(diethylamino)acetamide structure
|
Common Name | N-[cyclopropyl(phenyl)methyl]-2-(diethylamino)acetamide | ||
|---|---|---|---|---|
| CAS Number | 23459-53-2 | Molecular Weight | 260.37500 | |
| Density | 1.064g/cm3 | Boiling Point | 421.3ºC at 760mmHg | |
| Molecular Formula | C16H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | N-[cyclopropyl(phenyl)methyl]-2-(diethylamino)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.064g/cm3 |
|---|---|
| Boiling Point | 421.3ºC at 760mmHg |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.37500 |
| Flash Point | 208.6ºC |
| Exact Mass | 260.18900 |
| PSA | 35.83000 |
| LogP | 3.43600 |
| Vapour Pressure | 2.64E-07mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | REESMHGNRVHAOE-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(=O)NC(c1ccccc1)C1CC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ls-8776 |