2,6-dimethylhept-3-en-4-yloxy(trimethyl)silane structure
|
Common Name | 2,6-dimethylhept-3-en-4-yloxy(trimethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 2346-34-1 | Molecular Weight | 214.42000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-dimethylhept-3-en-4-yloxy(trimethyl)silane |
|---|
| Molecular Formula | C12H26OSi |
|---|---|
| Molecular Weight | 214.42000 |
| Exact Mass | 214.17500 |
| PSA | 9.23000 |
| LogP | 4.42390 |
| InChIKey | CAGMQMIUDOYGDA-UHFFFAOYSA-N |
| SMILES | CC(C)C=C(CC(C)C)O[Si](C)(C)C |
| HS Code | 2931900090 |
|---|
|
~75%
2,6-dimethylhep... CAS#:2346-34-1 |
| Literature: Reetz, Manfred T.; Maier, Wilhelm F.; Chatziiosifidis, Ioannis; Giannis, Athanassios; Heimbach, Horst; Loewe, Ursula Chemische Berichte, 1980 , vol. 113, # 12 p. 3741 - 3757 |
|
~59%
2,6-dimethylhep... CAS#:2346-34-1 |
| Literature: Gmelin Handbook: Sn: Org.Comp.12, 1.4.1.1.1.5.2.2, page 97 - 113 |
|
~%
2,6-dimethylhep... CAS#:2346-34-1 |
| Literature: Gmelin Handbook: Sn: Org.Comp.12, 1.4.1.1.1.5.2.2, page 97 - 113 |
|
~%
2,6-dimethylhep... CAS#:2346-34-1 |
| Literature: Gmelin Handbook: Sn: Org.Comp.12, 1.4.1.1.1.5.2.2, page 97 - 113 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |