4-(dipropylamino)-3,5-dinitrobenzoic acid
Modify Date: 2025-09-12 17:20:30
4-(dipropylamino)-3,5-dinitrobenzoic acid structure
|
Common Name | 4-(dipropylamino)-3,5-dinitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2347-38-8 | Molecular Weight | 311.29100 | |
| Density | 1.355g/cm3 | Boiling Point | 461.1ºC at 760mmHg | |
| Molecular Formula | C13H17N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.7ºC | |
| Name | 4-(dipropylamino)-3,5-dinitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 461.1ºC at 760mmHg |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29100 |
| Flash Point | 232.7ºC |
| Exact Mass | 311.11200 |
| PSA | 132.18000 |
| LogP | 3.87400 |
| Vapour Pressure | 2.67E-09mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | XTHSJCATZGIZLX-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)c1c([N+](=O)[O-])cc(C(=O)O)cc1[N+](=O)[O-] |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| 4-dipropylamino-3,5-dinitrobenzoic acid |
| 4-Dipropylamino-3,5-dinitro-benzoesaeure |
| T0500-9889 |
| Dipropylamino-dinitro-benzoic acid |