1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one structure
|
Common Name | 1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 2350-46-1 | Molecular Weight | 233.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,3-dichloro-4-hydroxyphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10Cl2O2 |
|---|---|
| Molecular Weight | 233.09100 |
| Exact Mass | 232.00600 |
| PSA | 37.30000 |
| LogP | 3.68180 |
| InChIKey | MRAKITVQDPSLMI-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1ccc(O)c(Cl)c1Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,3-dichloro-4-butyroylphenol |
| 4-Butyryl-2,3-dichlorophenol |
| 2',3'-Dichlor-4'-hydroxybutyrophenon |
| 1-Butanone,1-(2,3-dichloro-4-hydroxyphenyl) |
| Butyrophenone,2',3'-dichloro-4'-hydroxy-(7CI,8CI) |
| 2,3-dichloro-4-butyrylphenol |
| 2-Aethyl-2'.3'-dichlor-4'-hydroxyacetophenon |
| 2.3-Dichlor-4-butyryl-phenol |
| 2',3'-dichloro-4'-hydroxybutyrophenone |