4-(toluene-4-sulfonyloxy)-cyclohexanone structure
|
Common Name | 4-(toluene-4-sulfonyloxy)-cyclohexanone | ||
|---|---|---|---|---|
| CAS Number | 23511-04-8 | Molecular Weight | 268.32900 | |
| Density | 1.28g/cm3 | Boiling Point | 431.2ºC at 760 mmHg | |
| Molecular Formula | C13H16O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.6ºC | |
| Name | 4-(toluene-4-sulfonyloxy)-cyclohexanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 431.2ºC at 760 mmHg |
| Molecular Formula | C13H16O4S |
| Molecular Weight | 268.32900 |
| Flash Point | 214.6ºC |
| Exact Mass | 268.07700 |
| PSA | 68.82000 |
| LogP | 3.29280 |
| Vapour Pressure | 1.22E-07mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | WDKMRHPBPTUYDX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCC(=O)CC2)cc1 |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 4-ketocyclohexyl tosylate |
| 4-(Toluol-4-sulfonyloxy)-cyclohexanon |
| 4-tosylcyclohexanone |
| 4-tosyloxycyclohexanone |
| toluene-4-sulfonic acid 4-oxo-cyclohexyl ester |
| 4-Oxocyclohexan-1-ol p-toluenesulfonate |