2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid
Modify Date: 2025-08-29 20:30:27
![2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid Structure](https://www.chemsrc.com/extcaspic/323/2351872-44-9.png)
2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid structure
|
Common Name | 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2351872-44-9 | Molecular Weight | 290.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H18N2O4 |
|---|---|
| Molecular Weight | 290.31 |
| InChIKey | CJRDWIZWFYJZNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1cccc2cc[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid? |
| A: CAS number of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid is 2351872-44-9. |
| Q: What is the molecular weight of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid? |
| A: Molecular weight of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid is 290.31. |
| Q: What is the Chinese name of 2351872-44-9? |
| A: Chinese name of 2351872-44-9 is 2351872-44-9. |
| Q: What is the English name of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid? |
| A: The English name of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid is 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid. |
| Q: What is the molecular formula of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid? |
| A: Molecular formula of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid is C15H18N2O4. |
| Q: What is the SMILES notation of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid? |
| A: SMILES notation of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid is CC(C)(C)OC(=O)NC(C(=O)O)c1cccc2cc[nH]c12. |
| Q: What is the InChIKey of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid? |
| A: InChIKey of 2-{[(tert-butoxy)carbonyl]amino}-2-(1H-indol-7-yl)acetic acid is CJRDWIZWFYJZNT-UHFFFAOYSA-N. |