Gly-Gly-Gly-PEG4-DBCO structure
|
Common Name | Gly-Gly-Gly-PEG4-DBCO | ||
|---|---|---|---|---|
| CAS Number | 2353409-80-8 | Molecular Weight | 694.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H46N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Gly-Gly-Gly-PEG4-DBCOGly-Gly-Gly-PEG4-DBCO is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Gly-Gly-Gly-PEG4-DBCO |
|---|
| Description | Gly-Gly-Gly-PEG4-DBCO is a cleavable 4 unit PEG ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. |
| References |
| Molecular Formula | C35H46N6O9 |
|---|---|
| Molecular Weight | 694.77 |
| InChIKey | IQIPCHLKYRUJEB-UHFFFAOYSA-N |
| SMILES | NCC(=O)NCC(=O)NCC(=O)NCCOCCOCCOCCOCCNC(=O)CCC(=O)N1Cc2ccccc2C#Cc2ccccc21 |