BDY 650-X, SE structure
|
Common Name | BDY 650-X, SE | ||
|---|---|---|---|---|
| CAS Number | 235439-04-0 | Molecular Weight | 643.445 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H32BF2N5O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDY 650-X, SEBDP 650/665 is a borondipyrromethene dye with far red excitation and emission. The dye has a good molar extinction coefficient and emission quantum yield. The NHS ester can be conjugated with amine groups of proteins, peptides, and other molecules. The molecule contains an additional aminohexanoic acid linker. |
| Name | (2-{4-[(E)-2-{2-[(1H,1'H-2,2'-Bipyrrol-5-yl-κN1)methylene]-2H-pyrrol-5-yl-κN}vinyl]phenoxy}-N-{6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl}acetamidato)(difluoro)boronato |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C33H32BF2N5O6 |
|---|---|
| Molecular Weight | 643.445 |
| Exact Mass | 643.241394 |
| InChIKey | CDXXFTJLAKSQSR-JXMROGBWSA-N |
| SMILES | O=C(COc1ccc(C=Cc2ccc3n2[B-](F)(F)[N+]2=C(c4ccc[nH]4)C=CC2=C3)cc1)NCCCCCC(=O)ON1C(=O)CCC1=O |
| (2-{4-[(E)-2-{2-[(1H,1'H-2,2'-Bipyrrol-5-yl-κN1)methylene]-2H-pyrrol-5-yl-κN}vinyl]phenoxy}-N-{6-[(2,5-dioxo-1-pyrrolidinyl)oxy]-6-oxohexyl}acetamidato)(difluoro)boronato |