N-[3-m-tolylamino]-2-propenylidene]-m-toluidine structure
|
Common Name | N-[3-m-tolylamino]-2-propenylidene]-m-toluidine | ||
|---|---|---|---|---|
| CAS Number | 23545-77-9 | Molecular Weight | 250.33800 | |
| Density | 0.97g/cm3 | Boiling Point | 401.4ºC at 760mmHg | |
| Molecular Formula | C17H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.6ºC | |
| Name | 3-methyl-N-[3-(3-methylphenyl)iminoprop-1-enyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 401.4ºC at 760mmHg |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.33800 |
| Flash Point | 196.6ºC |
| Exact Mass | 250.14700 |
| PSA | 24.39000 |
| LogP | 4.70450 |
| Vapour Pressure | 1.18E-06mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | YLFXCOHVYROVSG-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N=CC=CNc2cccc(C)c2)c1 |
|
~62%
N-[3-m-tolylami... CAS#:23545-77-9 |
| Literature: Tamura; Ono; Furuyama Chemical and Pharmaceutical Bulletin, 1980 , vol. 28, # 8 p. 2356 - 2366 |
|
~%
N-[3-m-tolylami... CAS#:23545-77-9 |
| Literature: McNab, Hamish; Murray, M. Elizabeth-Ann Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 7 p. 1565 - 1568 |
| einecs 245-725-5 |