2'-Fluoro-2,4',5'-trichloroacetanilide structure
|
Common Name | 2'-Fluoro-2,4',5'-trichloroacetanilide | ||
|---|---|---|---|---|
| CAS Number | 23554-66-7 | Molecular Weight | 256.48900 | |
| Density | 1.583g/cm3 | Boiling Point | 371.6ºC at 760 mmHg | |
| Molecular Formula | C8H5Cl3FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | 2-chloro-N-(4,5-dichloro-2-fluorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.583g/cm3 |
|---|---|
| Boiling Point | 371.6ºC at 760 mmHg |
| Molecular Formula | C8H5Cl3FNO |
| Molecular Weight | 256.48900 |
| Flash Point | 178.5ºC |
| Exact Mass | 254.94200 |
| PSA | 32.59000 |
| LogP | 3.95930 |
| Vapour Pressure | 1.02E-05mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | KCRLIDURMKQYFB-UHFFFAOYSA-N |
| SMILES | O=C(CCl)Nc1cc(Cl)c(Cl)cc1F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2'-Fluoro-2,4',5'-trichloroacetanilide |
| ACETANILIDE,2'-FLUORO-2,4',5'-TRICHLORO |