N'-(4-hydroxyphenyl)naphthalene-1-carboximidamide structure
|
Common Name | N'-(4-hydroxyphenyl)naphthalene-1-carboximidamide | ||
|---|---|---|---|---|
| CAS Number | 23564-92-3 | Molecular Weight | 262.30600 | |
| Density | 1.19g/cm3 | Boiling Point | 509.2ºC at 760mmHg | |
| Molecular Formula | C17H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.8ºC | |
| Name | N'-(4-hydroxyphenyl)naphthalene-1-carboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 509.2ºC at 760mmHg |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30600 |
| Flash Point | 261.8ºC |
| Exact Mass | 262.11100 |
| PSA | 56.11000 |
| LogP | 4.15560 |
| Vapour Pressure | 5.42E-11mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | JFUPPPQAMSJQBF-UHFFFAOYSA-N |
| SMILES | NC(=Nc1ccc(O)cc1)c1cccc2ccccc12 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Hydroxy-4'-phenyl-naphthalino-1-amidin |