4-chloro-5-dimethylamino-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one structure
|
Common Name | 4-chloro-5-dimethylamino-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 23576-23-0 | Molecular Weight | 317.69400 | |
| Density | 1.38g/cm3 | Boiling Point | 340.6ºC at 760mmHg | |
| Molecular Formula | C13H11ClF3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.8ºC | |
| Name | metflurazon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 340.6ºC at 760mmHg |
| Molecular Formula | C13H11ClF3N3O |
| Molecular Weight | 317.69400 |
| Flash Point | 159.8ºC |
| Exact Mass | 317.05400 |
| PSA | 38.13000 |
| LogP | 2.97070 |
| Vapour Pressure | 8.53E-05mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | CYQMVKQKBFFDOO-UHFFFAOYSA-N |
| SMILES | CN(C)c1cnn(-c2cccc(C(F)(F)F)c2)c(=O)c1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]-3(2H)-pyridazinone |
| Sandoz 6706 |
| 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3-one |
| 4-chloro-5-dimethylamino-2-(α,α,α-trifluoro-m-tolyl)pyridazin-3(2H)-one |
| 4-chloro-5-(dimethylamino)-2-[3-(trifluoromethyl)phenyl]pyridazin-3(2H)-one |
| San 6706-3197 |
| Metflurazon |
| SAN 6706 |