2-[4-(2-methyl-4,5-dihydrobenzo[1,2]cyclohepta[3,4-c][1,3]oxazol-10-ylidene)piperidin-1-yl]ethyl acetate structure
|
Common Name | 2-[4-(2-methyl-4,5-dihydrobenzo[1,2]cyclohepta[3,4-c][1,3]oxazol-10-ylidene)piperidin-1-yl]ethyl acetate | ||
|---|---|---|---|---|
| CAS Number | 23598-99-4 | Molecular Weight | 366.45300 | |
| Density | 1.179g/cm3 | Boiling Point | 518.1ºC at 760mmHg | |
| Molecular Formula | C22H26N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.1ºC | |
| Name | 2-[4-(2-methyl-4,5-dihydrobenzo[1,2]cyclohepta[3,4-c][1,3]oxazol-10-ylidene)piperidin-1-yl]ethyl acetate |
|---|
| Density | 1.179g/cm3 |
|---|---|
| Boiling Point | 518.1ºC at 760mmHg |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.45300 |
| Flash Point | 267.1ºC |
| Exact Mass | 366.19400 |
| PSA | 55.57000 |
| LogP | 3.48030 |
| Vapour Pressure | 7.75E-11mmHg at 25°C |
| Index of Refraction | 1.576 |
| InChIKey | NGFQYLISIAHICE-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCN1CCC(=C2c3ccccc3CCc3oc(C)nc32)CC1 |
|
~%
2-[4-(2-methyl-... CAS#:23598-99-4 |
| Literature: Galantay,E.E. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, p. 1316 - 1327 |
|
~%
2-[4-(2-methyl-... CAS#:23598-99-4 |
| Literature: Galantay,E.E. et al. Journal of Medicinal Chemistry, 1974 , vol. 17, p. 1316 - 1327 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |