[2-(2-Pyridyl)ethenyl]phosphonic acid dibutyl ester structure
|
Common Name | [2-(2-Pyridyl)ethenyl]phosphonic acid dibutyl ester | ||
|---|---|---|---|---|
| CAS Number | 23614-28-0 | Molecular Weight | 297.33000 | |
| Density | 1.077g/cm3 | Boiling Point | 406.9ºC at 760 mmHg | |
| Molecular Formula | C15H24NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.9ºC | |
| Name | 2-[(E)-2-dibutoxyphosphorylethenyl]pyridine |
|---|
| Density | 1.077g/cm3 |
|---|---|
| Boiling Point | 406.9ºC at 760 mmHg |
| Molecular Formula | C15H24NO3P |
| Molecular Weight | 297.33000 |
| Flash Point | 199.9ºC |
| Exact Mass | 297.14900 |
| PSA | 58.23000 |
| LogP | 4.87880 |
| Vapour Pressure | 1.85E-06mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | JVWJNXLTZSBRJA-GXDHUFHOSA-N |
| SMILES | CCCCOP(=O)(C=Cc1ccccn1)OCCCC |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |