N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide structure
|
Common Name | N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 2361663-80-9 | Molecular Weight | 315.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H21N3O3 |
|---|---|
| Molecular Weight | 315.37 |
| InChIKey | CGFRJJKHJXKJOR-UHFFFAOYSA-N |
| SMILES | C=CC(=O)N(CC)CC(=O)NC1CCc2ccccc2NC1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide? |
| A: Molecular formula of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide is C17H21N3O3. |
| Q: What is the SMILES notation of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide? |
| A: SMILES notation of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide is C=CC(=O)N(CC)CC(=O)NC1CCc2ccccc2NC1=O. |
| Q: What is the English name of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide? |
| A: The English name of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide is N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide. |
| Q: What is the CAS number of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide? |
| A: CAS number of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide is 2361663-80-9. |
| Q: What is the InChIKey of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide? |
| A: InChIKey of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide is CGFRJJKHJXKJOR-UHFFFAOYSA-N. |
| Q: What is the molecular weight of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide? |
| A: Molecular weight of N-ethyl-N-{[(2-oxo-2,3,4,5-tetrahydro-1H-1-benzazepin-3-yl)carbamoyl]methyl}prop-2-enamide is 315.37. |
| Q: What is the Chinese name of 2361663-80-9? |
| A: Chinese name of 2361663-80-9 is 2361663-80-9. |