4,4'-Cyclohexane-1,1-diylbis(2-methylphenol) structure
|
Common Name | 4,4'-Cyclohexane-1,1-diylbis(2-methylphenol) | ||
|---|---|---|---|---|
| CAS Number | 2362-14-3 | Molecular Weight | 296.403 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 450.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O2 | Melting Point | 184ºC | |
| MSDS | N/A | Flash Point | 205.6±23.3 °C | |
| Name | 4-[1-(4-hydroxy-3-methylphenyl)cyclohexyl]-2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 450.0±45.0 °C at 760 mmHg |
| Melting Point | 184ºC |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.403 |
| Flash Point | 205.6±23.3 °C |
| Exact Mass | 296.177643 |
| PSA | 40.46000 |
| LogP | 5.45 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | SVOBELCYOCEECO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C2(c3ccc(O)c(C)c3)CCCCC2)ccc1O |
| HS Code | 2907299090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 8 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| 4,4'-(1,1-Cyclohexanediyl)bis(2-methylphenol) |
| 4,4'-Cyclohexane-1,1-diylbis(2-methylphenol) |
| Phenol, 4,4'-cyclohexylidenebis[2-methyl- |
| EINECS 219-110-7 |
| 4,4'-Cyclohexylidenebis(o-cresol) |
| 4,4'-Cyclohexylidenebis(2-methylphenol) |
| 1,1-Bis(4-hydroxy-3-Methylphenyl)cyclohexane |