Benzaldehyde,3-(2,4-dinitrophenoxy)- structure
|
Common Name | Benzaldehyde,3-(2,4-dinitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 2363-11-3 | Molecular Weight | 288.21200 | |
| Density | 1.475g/cm3 | Boiling Point | 440.4ºC at 760mmHg | |
| Molecular Formula | C13H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.1ºC | |
| Name | 3-(2,4-dinitrophenoxy)benzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.475g/cm3 |
|---|---|
| Boiling Point | 440.4ºC at 760mmHg |
| Molecular Formula | C13H8N2O6 |
| Molecular Weight | 288.21200 |
| Flash Point | 199.1ºC |
| Exact Mass | 288.03800 |
| PSA | 117.94000 |
| LogP | 4.15420 |
| Vapour Pressure | 5.92E-08mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | YYQMCEXJWQWUFK-UHFFFAOYSA-N |
| SMILES | O=Cc1cccc(Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| HS Code | 2913000090 |
|---|
|
~%
Benzaldehyde,3-... CAS#:2363-11-3 |
| Literature: Brady; Bodger Journal of the Chemical Society, 1932 , p. 952,955 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-Formyl-2',4'-dinitro-diphenylether |