4-[[4-(diethylamino)phenyl]imino]naphthalen-1(4H)-one structure
|
Common Name | 4-[[4-(diethylamino)phenyl]imino]naphthalen-1(4H)-one | ||
|---|---|---|---|---|
| CAS Number | 2363-99-7 | Molecular Weight | 304.38600 | |
| Density | 1.08g/cm3 | Boiling Point | 451.4ºC at 760mmHg | |
| Molecular Formula | C20H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.8ºC | |
| Name | 4-[4-(diethylamino)phenyl]iminonaphthalen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 451.4ºC at 760mmHg |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.38600 |
| Flash Point | 226.8ºC |
| Exact Mass | 304.15800 |
| PSA | 32.67000 |
| LogP | 4.40610 |
| Vapour Pressure | 2.45E-08mmHg at 25°C |
| Index of Refraction | 1.59 |
| InChIKey | GFZAEDHEVXNEEA-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(N=C2C=CC(=O)c3ccccc32)cc1 |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-[[4-(DIETHYLAMINO)PHENYL]IMINO]NAPHTHALEN-1(4H)-ONE |
| Naphthochinon-(1,4)-mono-<4-diaethylamino-anil> 4-(4-Diaethylamino-phenylimino)-4H-naphthalin-1-on |
| EINECS 219-118-0 |
| [1,4]naphthoquinone-mono-(4-diethylamino-phenylimine) |
| [1,4]Naphthochinon-mono-(4-diaethylamino-phenylimin) |